C29H41FN4O5S3 — CID 155559536
S-[(Z)-4-fluoro-4-[(5R,8S,11R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate (PubChem CID 155559536) has the molecular formula C29H41FN4O5S3 and a molecular weight of 640.87 g/mol. Its IUPAC name is S-[(Z)-4-fluoro-4-[(5R,8S,11R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(Z)-4-fluoro-4-[(5R,8S,11R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 155559536 |
| Molecular Formula | C29H41FN4O5S3 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | S-[(Z)-4-fluoro-4-[(5R,8S,11R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C(\F)[C@H]1CC(=O)NCc2nc(cs2)C2=N[C@@](C)(CS2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C29H41FN4O5S3/c1-5-6-7-8-9-12-24(36)40-13-10-11-19(30)21-14-22(35)31-15-23-32-20(16-41-23)26-34-29(4,17-42-26)28(38)33-25(18(2)3)27(37)39-21/h11,16,18,21,25H,5-10,12-15,17H2,1-4H3,(H,31,35)(H,33,38)/b19-11-/t21-,25+,29+/m1/s1 |
| InChIKey | SFAXIIRLEIWVMY-GIUPMQLUSA-N |
| XLogP | 5.33 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|