C31H44N4O5S2 — CID 145152499
S-[(E)-4-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3-thia-7,14,17,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate (PubChem CID 145152499) has the molecular formula C31H44N4O5S2 and a molecular weight of 616.85 g/mol. Its IUPAC name is S-[(E)-4-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3-thia-7,14,17,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3-thia-7,14,17,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 145152499 |
| Molecular Formula | C31H44N4O5S2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | S-[(E)-4-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3-thia-7,14,17,21-tetrazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/C1CC(=O)NCc2cc(ccn2)C2=N[C@@](C)(CS2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C31H44N4O5S2/c1-5-6-7-8-9-13-26(37)41-16-11-10-12-24-18-25(36)33-19-23-17-22(14-15-32-23)28-35-31(4,20-42-28)30(39)34-27(21(2)3)29(38)40-24/h10,12,14-15,17,21,24,27H,5-9,11,13,16,18-20H2,1-4H3,(H,33,36)(H,34,39)/b12-10+/t24?,27-,31-/m0/s1 |
| InChIKey | GENMLQRMGWMMBT-NNQRZTDLSA-N |
| XLogP | 4.97 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|