C29H42N4O7S — CID 59179776
S-[(E)-4-[(5S,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate (PubChem CID 59179776) has the molecular formula C29H42N4O7S and a molecular weight of 590.74 g/mol. Its IUPAC name is S-[(E)-4-[(5S,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(5S,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 59179776 |
| Molecular Formula | C29H42N4O7S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | S-[(E)-4-[(5S,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/C1CC(=O)NCc2nc(co2)C2=N[C@@](C)(CO2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C29H42N4O7S/c1-5-6-7-8-9-13-24(35)41-14-11-10-12-20-15-22(34)30-16-23-31-21(17-38-23)26-33-29(4,18-39-26)28(37)32-25(19(2)3)27(36)40-20/h10,12,17,19-20,25H,5-9,11,13-16,18H2,1-4H3,(H,30,34)(H,32,37)/b12-10+/t20?,25-,29-/m0/s1 |
| InChIKey | DVKJEZFHAOBEQF-NYXBXBPESA-N |
| XLogP | 3.85 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|