C27H40N4O7S — CID 54754627
S-[(E)-4-[(7S,10S)-4,4,7-trimethyl-2,5,8,12-tetraoxo-9,16-dioxa-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-10-yl]but-3-enyl] octanethioate (PubChem CID 54754627) has the molecular formula C27H40N4O7S and a molecular weight of 564.71 g/mol. Its IUPAC name is S-[(E)-4-[(7S,10S)-4,4,7-trimethyl-2,5,8,12-tetraoxo-9,16-dioxa-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-10-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(7S,10S)-4,4,7-trimethyl-2,5,8,12-tetraoxo-9,16-dioxa-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-10-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 54754627 |
| Molecular Formula | C27H40N4O7S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | S-[(E)-4-[(7S,10S)-4,4,7-trimethyl-2,5,8,12-tetraoxo-9,16-dioxa-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-10-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2nc(co2)C(=O)NC(C)(C)C(=O)N[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C27H40N4O7S/c1-5-6-7-8-9-13-23(33)39-14-11-10-12-19-15-21(32)28-16-22-30-20(17-37-22)24(34)31-27(3,4)26(36)29-18(2)25(35)38-19/h10,12,17-19H,5-9,11,13-16H2,1-4H3,(H,28,32)(H,29,36)(H,31,34)/b12-10+/t18-,19+/m0/s1 |
| InChIKey | NWQYEUMKLJLYRB-GMIBQGTOSA-N |
| XLogP | 3.19 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|