C29H44N4O7S — CID 88592287
S-[(E)-4-[(8S)-2-methylimino-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19-triazabicyclo[14.2.1]nonadeca-1(18),16(19)-dien-11-yl]but-3-enyl] octanethioate (PubChem CID 88592287) has the molecular formula C29H44N4O7S and a molecular weight of 592.76 g/mol. Its IUPAC name is S-[(E)-4-[(8S)-2-methylimino-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19-triazabicyclo[14.2.1]nonadeca-1(18),16(19)-dien-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(8S)-2-methylimino-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19-triazabicyclo[14.2.1]nonadeca-1(18),16(19)-dien-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 88592287 |
| Molecular Formula | C29H44N4O7S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | S-[(E)-4-[(8S)-2-methylimino-6,9,13-trioxo-8-propan-2-yl-3,10,17-trioxa-7,14,19-triazabicyclo[14.2.1]nonadeca-1(18),16(19)-dien-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/C1CC(=O)NCc2nc(co2)/C(=N\C)OCCC(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C29H44N4O7S/c1-5-6-7-8-9-13-26(36)41-16-11-10-12-21-17-24(35)31-18-25-32-22(19-39-25)28(30-4)38-15-14-23(34)33-27(20(2)3)29(37)40-21/h10,12,19-21,27H,5-9,11,13-18H2,1-4H3,(H,31,35)(H,33,34)/b12-10+,30-28+/t21?,27-/m0/s1 |
| InChIKey | QPOMGCTWGZKDBB-QRAMIKHQSA-N |
| XLogP | 4.10 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|