C28H40N6O5S2 — CID 71540743
S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-18-thia-3,4,5,8,15,20-hexazatricyclo[15.2.1.12,5]henicosa-1(19),2(21),3,17(20)-tetraen-12-yl]but-3-enyl] octanethioate (PubChem CID 71540743) has the molecular formula C28H40N6O5S2 and a molecular weight of 604.80 g/mol. Its IUPAC name is S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-18-thia-3,4,5,8,15,20-hexazatricyclo[15.2.1.12,5]henicosa-1(19),2(21),3,17(20)-tetraen-12-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-18-thia-3,4,5,8,15,20-hexazatricyclo[15.2.1.12,5]henicosa-1(19),2(21),3,17(20)-tetraen-12-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 71540743 |
| Molecular Formula | C28H40N6O5S2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | S-[(E)-4-[(9S,12S)-7,10,14-trioxo-9-propan-2-yl-11-oxa-18-thia-3,4,5,8,15,20-hexazatricyclo[15.2.1.12,5]henicosa-1(19),2(21),3,17(20)-tetraen-12-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2nc(cs2)-c2cn(nn2)CC(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C28H40N6O5S2/c1-4-5-6-7-8-12-26(37)40-13-10-9-11-20-14-23(35)29-15-25-30-22(18-41-25)21-16-34(33-32-21)17-24(36)31-27(19(2)3)28(38)39-20/h9,11,16,18-20,27H,4-8,10,12-15,17H2,1-3H3,(H,29,35)(H,31,36)/b11-9+/t20-,27+/m1/s1 |
| InChIKey | HEXVAEOXQIHDTH-MZWYABKVSA-N |
| XLogP | 4.04 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|