C9H7F2N — CID 123926157
2-(3,4-difluorophenyl)cyclopropan-1-imine (PubChem CID 123926157) has the molecular formula C9H7F2N and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)cyclopropan-1-imine.
| Compound Name | 2-(3,4-difluorophenyl)cyclopropan-1-imine |
|---|---|
| PubChem CID | 123926157 |
| Molecular Formula | C9H7F2N |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-(3,4-difluorophenyl)cyclopropan-1-imine |
| SMILES | [H]/N=C1\CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H7F2N/c10-7-2-1-5(3-8(7)11)6-4-9(6)12/h1-3,6,12H,4H2/b12-9+ |
| InChIKey | AYVNBIBJNIJXMR-FMIVXFBMSA-N |
| XLogP | 2.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|