C11H11F3O3S — CID 123926765
4-ethenyl-2,5,6-trifluoro-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 123926765) has the molecular formula C11H11F3O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is 4-ethenyl-2,5,6-trifluoro-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 4-ethenyl-2,5,6-trifluoro-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 123926765 |
| Molecular Formula | C11H11F3O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 4-ethenyl-2,5,6-trifluoro-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | C=CC1=C(C(=C)C)C(F)=C(S(=O)(=O)O)C(F)C1F |
| InChI | InChI=1S/C11H11F3O3S/c1-4-6-7(5(2)3)9(13)11(18(15,16)17)10(14)8(6)12/h4,8,10H,1-2H2,3H3,(H,15,16,17) |
| InChIKey | IGWYCWKIWYUWAD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|