C8H5F4O3S- — CID 91042551
4-ethenyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 91042551) has the molecular formula C8H5F4O3S- and a molecular weight of 257.18 g/mol. Its IUPAC name is 4-ethenyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 4-ethenyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 91042551 |
| Molecular Formula | C8H5F4O3S- |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 4-ethenyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | C=[C-]C1=C(F)C(F)=C(S(=O)(=O)O)C(F)C1F |
| InChI | InChI=1S/C8H5F4O3S/c1-2-3-4(9)6(11)8(16(13,14)15)7(12)5(3)10/h4,6H,1H2,(H,13,14,15)/q-1 |
| InChIKey | PEOOWUZEMOIFLL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|