C7H6F4O3S — CID 90968295
2,3,5,6-tetrafluoro-4-methylcyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 90968295) has the molecular formula C7H6F4O3S and a molecular weight of 246.18 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methylcyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-methylcyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 90968295 |
| Molecular Formula | C7H6F4O3S |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methylcyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | CC1=C(F)C(F)=C(S(=O)(=O)O)C(F)C1F |
| InChI | InChI=1S/C7H6F4O3S/c1-2-3(8)5(10)7(15(12,13)14)6(11)4(2)9/h3,5H,1H3,(H,12,13,14) |
| InChIKey | HVEHBBGFYYJMRT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|