C8H8F4O3S — CID 163611030
4-ethyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 163611030) has the molecular formula C8H8F4O3S and a molecular weight of 260.21 g/mol. Its IUPAC name is 4-ethyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 4-ethyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 163611030 |
| Molecular Formula | C8H8F4O3S |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4-ethyl-2,3,5,6-tetrafluorocyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | CCC1=C(F)C(F)=C(S(=O)(=O)O)C(F)C1F |
| InChI | InChI=1S/C8H8F4O3S/c1-2-3-4(9)6(11)8(16(13,14)15)7(12)5(3)10/h4,6H,2H2,1H3,(H,13,14,15) |
| InChIKey | HFXQSCUVOBXOGL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|