C14H18F2O3S — CID 123528032
2-ethyl-5,6-difluoro-3,4-bis(prop-1-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 123528032) has the molecular formula C14H18F2O3S and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-ethyl-5,6-difluoro-3,4-bis(prop-1-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 2-ethyl-5,6-difluoro-3,4-bis(prop-1-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 123528032 |
| Molecular Formula | C14H18F2O3S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-ethyl-5,6-difluoro-3,4-bis(prop-1-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | C=C(C)C1=C(C(=C)C)C(F)C(F)C(S(=O)(=O)O)=C1CC |
| InChI | InChI=1S/C14H18F2O3S/c1-6-9-10(7(2)3)11(8(4)5)12(15)13(16)14(9)20(17,18)19/h12-13H,2,4,6H2,1,3,5H3,(H,17,18,19) |
| InChIKey | GXDFMGXAWXQFEB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|