C13H17FO3S — CID 123572396
4-ethenyl-5-fluoro-2,6-dimethyl-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 123572396) has the molecular formula C13H17FO3S and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-ethenyl-5-fluoro-2,6-dimethyl-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 4-ethenyl-5-fluoro-2,6-dimethyl-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 123572396 |
| Molecular Formula | C13H17FO3S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-ethenyl-5-fluoro-2,6-dimethyl-3-prop-1-en-2-ylcyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | C=CC1=C(C(=C)C)C(C)=C(S(=O)(=O)O)C(C)C1F |
| InChI | InChI=1S/C13H17FO3S/c1-6-10-11(7(2)3)8(4)13(18(15,16)17)9(5)12(10)14/h6,9,12H,1-2H2,3-5H3,(H,15,16,17) |
| InChIKey | YYQBRYUPLSAREB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|