C34H36N6O+2 — CID 123927264
3-tert-butyl-N-[3-cyano-5-[2-(5-methylbenzimidazole-1,3-diium-1-yl)ethynyl]phenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 123927264) has the molecular formula C34H36N6O+2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 3-tert-butyl-N-[3-cyano-5-[2-(5-methylbenzimidazole-1,3-diium-1-yl)ethynyl]phenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | 3-tert-butyl-N-[3-cyano-5-[2-(5-methylbenzimidazole-1,3-diium-1-yl)ethynyl]phenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 123927264 |
| Molecular Formula | C34H36N6O+2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 3-tert-butyl-N-[3-cyano-5-[2-(5-methylbenzimidazole-1,3-diium-1-yl)ethynyl]phenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | Cc1ccc2c(c1)=[N+]=C[N+]=2C#Cc1cc(C#N)cc(NC(=O)c2ccc(CN3CCN(C)CC3)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C34H35N6O/c1-24-6-9-32-31(16-24)36-23-40(32)11-10-25-17-26(21-35)19-29(18-25)37-33(41)27-7-8-28(30(20-27)34(2,3)4)22-39-14-12-38(5)13-15-39/h6-9,16-20,23H,12-15,22H2,1-5H3/q+1/p+1 |
| InChIKey | NOYLXZGQEHSWLM-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|