C30H33NOP2 — CID 123927813
N-diphenylphosphanyl-N-[4-methoxyhepta-2,4-dien-6-yn-3-yl(phenyl)phosphanyl]butan-1-amine (PubChem CID 123927813) has the molecular formula C30H33NOP2 and a molecular weight of 485.55 g/mol. Its IUPAC name is N-diphenylphosphanyl-N-[4-methoxyhepta-2,4-dien-6-yn-3-yl(phenyl)phosphanyl]butan-1-amine.
| Compound Name | N-diphenylphosphanyl-N-[4-methoxyhepta-2,4-dien-6-yn-3-yl(phenyl)phosphanyl]butan-1-amine |
|---|---|
| PubChem CID | 123927813 |
| Molecular Formula | C30H33NOP2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-diphenylphosphanyl-N-[4-methoxyhepta-2,4-dien-6-yn-3-yl(phenyl)phosphanyl]butan-1-amine |
| SMILES | C#CC=C(OC)C(=CC)P(c1ccccc1)N(CCCC)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NOP2/c1-5-8-25-31(33(26-19-12-9-13-20-26)27-21-14-10-15-22-27)34(28-23-16-11-17-24-28)30(7-3)29(32-4)18-6-2/h2,7,9-24H,5,8,25H2,1,3-4H3 |
| InChIKey | PUIOSQJJMDKBIY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|