C28H35NP2 — CID 134344233
(1S,3R)-N-butyl-N-diphenylphosphanyl-1,3-diethyl-1,3-dihydroisophosphindol-2-amine (PubChem CID 134344233) has the molecular formula C28H35NP2 and a molecular weight of 447.54 g/mol. Its IUPAC name is (1S,3R)-N-butyl-N-diphenylphosphanyl-1,3-diethyl-1,3-dihydroisophosphindol-2-amine.
| Compound Name | (1S,3R)-N-butyl-N-diphenylphosphanyl-1,3-diethyl-1,3-dihydroisophosphindol-2-amine |
|---|---|
| PubChem CID | 134344233 |
| Molecular Formula | C28H35NP2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (1S,3R)-N-butyl-N-diphenylphosphanyl-1,3-diethyl-1,3-dihydroisophosphindol-2-amine |
| SMILES | CCCCN(P(c1ccccc1)c1ccccc1)P1[C@H](CC)c2ccccc2[C@@H]1CC |
| InChI | InChI=1S/C28H35NP2/c1-4-7-22-29(30(23-16-10-8-11-17-23)24-18-12-9-13-19-24)31-27(5-2)25-20-14-15-21-26(25)28(31)6-3/h8-21,27-28H,4-7,22H2,1-3H3/t27-,28+,31? |
| InChIKey | TVQUBRNRVQLKBS-SWRQNJEFSA-N |
| XLogP | 8.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|