C26H39NO2P2 — CID 139305496
(2R,5R)-N-bis(2-methoxyphenyl)phosphanyl-N-butyl-2,5-diethylphospholan-1-amine (PubChem CID 139305496) has the molecular formula C26H39NO2P2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (2R,5R)-N-bis(2-methoxyphenyl)phosphanyl-N-butyl-2,5-diethylphospholan-1-amine.
| Compound Name | (2R,5R)-N-bis(2-methoxyphenyl)phosphanyl-N-butyl-2,5-diethylphospholan-1-amine |
|---|---|
| PubChem CID | 139305496 |
| Molecular Formula | C26H39NO2P2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | (2R,5R)-N-bis(2-methoxyphenyl)phosphanyl-N-butyl-2,5-diethylphospholan-1-amine |
| SMILES | CCCCN(P(c1ccccc1OC)c1ccccc1OC)P1[C@H](CC)CC[C@H]1CC |
| InChI | InChI=1S/C26H39NO2P2/c1-6-9-20-27(30-21(7-2)18-19-22(30)8-3)31(25-16-12-10-14-23(25)28-4)26-17-13-11-15-24(26)29-5/h10-17,21-22H,6-9,18-20H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | SLTUKBZTQVYAMH-FGZHOGPDSA-N |
| XLogP | 6.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|