C21H27ClO5 — CID 123929379
2-(3-benzyl-4-chloro-5,6-dimethylcyclohexa-1,5-dien-1-yl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 123929379) has the molecular formula C21H27ClO5 and a molecular weight of 394.90 g/mol. Its IUPAC name is 2-(3-benzyl-4-chloro-5,6-dimethylcyclohexa-1,5-dien-1-yl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(3-benzyl-4-chloro-5,6-dimethylcyclohexa-1,5-dien-1-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123929379 |
| Molecular Formula | C21H27ClO5 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-(3-benzyl-4-chloro-5,6-dimethylcyclohexa-1,5-dien-1-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1=C(C)C(Cl)C(Cc2ccccc2)C=C1C1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C21H27ClO5/c1-11-12(2)17(22)14(8-13-6-4-3-5-7-13)9-15(11)21-20(26)19(25)18(24)16(10-23)27-21/h3-7,9,14,16-21,23-26H,8,10H2,1-2H3 |
| InChIKey | VQXSUVKSIGCGRU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|