C13H27N3 — CID 123930701
1-[1-(1,2-dimethylaziridin-2-yl)-2-methylpropan-2-yl]-4-methylpiperazine (PubChem CID 123930701) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-[1-(1,2-dimethylaziridin-2-yl)-2-methylpropan-2-yl]-4-methylpiperazine.
| Compound Name | 1-[1-(1,2-dimethylaziridin-2-yl)-2-methylpropan-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 123930701 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-[1-(1,2-dimethylaziridin-2-yl)-2-methylpropan-2-yl]-4-methylpiperazine |
| SMILES | CN1CCN(C(C)(C)CC2(C)CN2C)CC1 |
| InChI | InChI=1S/C13H27N3/c1-12(2,10-13(3)11-15(13)5)16-8-6-14(4)7-9-16/h6-11H2,1-5H3 |
| InChIKey | NBWYFZURSBFJGC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|