C20H39F3N2 — CID 143149531
1-methyl-4-(8,8,8-trifluoro-2,4,4,5,5,7,7-heptamethyloctan-2-yl)piperazine (PubChem CID 143149531) has the molecular formula C20H39F3N2 and a molecular weight of 364.54 g/mol. Its IUPAC name is 1-methyl-4-(8,8,8-trifluoro-2,4,4,5,5,7,7-heptamethyloctan-2-yl)piperazine.
| Compound Name | 1-methyl-4-(8,8,8-trifluoro-2,4,4,5,5,7,7-heptamethyloctan-2-yl)piperazine |
|---|---|
| PubChem CID | 143149531 |
| Molecular Formula | C20H39F3N2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1-methyl-4-(8,8,8-trifluoro-2,4,4,5,5,7,7-heptamethyloctan-2-yl)piperazine |
| SMILES | CN1CCN(C(C)(C)CC(C)(C)C(C)(C)CC(C)(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H39F3N2/c1-16(2,14-18(5,6)20(21,22)23)17(3,4)15-19(7,8)25-12-10-24(9)11-13-25/h10-15H2,1-9H3 |
| InChIKey | WACGRNAUAUJTMD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |