About carbon dioxide;7-methylquinolin-4-amine
carbon dioxide;7-methylquinolin-4-amine (PubChem CID 123936189) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is carbon dioxide;7-methylquinolin-4-amine.
Molecular Properties
| Compound Name | carbon dioxide;7-methylquinolin-4-amine |
| PubChem CID | 123936189 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | carbon dioxide;7-methylquinolin-4-amine |
| SMILES | Cc1ccc2c(N)ccnc2c1.O=C=O |
| InChI | InChI=1S/C10H10N2.CO2/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;2-1-3/h2-6H,1H3,(H2,11,12); |
| InChIKey | PKGCSEBGEDIPQR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;7-methylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;7-methylquinolin-4-amine?
The IUPAC name of carbon dioxide;7-methylquinolin-4-amine (CID 123936189) is carbon dioxide;7-methylquinolin-4-amine.
What is the SMILES notation for carbon dioxide;7-methylquinolin-4-amine?
The canonical SMILES for carbon dioxide;7-methylquinolin-4-amine is Cc1ccc2c(N)ccnc2c1.O=C=O.
What is the InChIKey of carbon dioxide;7-methylquinolin-4-amine?
The InChIKey is PKGCSEBGEDIPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.CO2/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;2-1-3/h2-6H,1H3,(H2,11,12);.
What are the key properties of carbon dioxide;7-methylquinolin-4-amine?
carbon dioxide;7-methylquinolin-4-amine has a molecular weight of 202.21 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;7-methylquinolin-4-amine is sourced from PubChem (CID 123936189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).