About (7-methylquinolin-4-yl)azanide;uranium
(7-methylquinolin-4-yl)azanide;uranium (PubChem CID 58700269) has the molecular formula C10H9N2U-
and a molecular weight of 395.23 g/mol. Its IUPAC name is (7-methylquinolin-4-yl)azanide;uranium.
Molecular Properties
| Compound Name | (7-methylquinolin-4-yl)azanide;uranium |
| PubChem CID | 58700269 |
| Molecular Formula | C10H9N2U- |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (7-methylquinolin-4-yl)azanide;uranium |
| SMILES | Cc1ccc2c([NH-])ccnc2c1.[U] |
| InChI | InChI=1S/C10H9N2.U/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;/h2-6H,1H3,(H-,11,12);/q-1; |
| InChIKey | PIAUOPASGXRIGE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7-methylquinolin-4-yl)azanide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methylquinolin-4-yl)azanide;uranium?
The IUPAC name of (7-methylquinolin-4-yl)azanide;uranium (CID 58700269) is (7-methylquinolin-4-yl)azanide;uranium.
What is the SMILES notation for (7-methylquinolin-4-yl)azanide;uranium?
The canonical SMILES for (7-methylquinolin-4-yl)azanide;uranium is Cc1ccc2c([NH-])ccnc2c1.[U].
What is the InChIKey of (7-methylquinolin-4-yl)azanide;uranium?
The InChIKey is PIAUOPASGXRIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N2.U/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;/h2-6H,1H3,(H-,11,12);/q-1;.
What are the key properties of (7-methylquinolin-4-yl)azanide;uranium?
(7-methylquinolin-4-yl)azanide;uranium has a molecular weight of 395.23 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methylquinolin-4-yl)azanide;uranium is sourced from PubChem (CID 58700269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).