C31H29O3S- — CID 123936639
5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzoyl]benzenesulfinate (PubChem CID 123936639) has the molecular formula C31H29O3S- and a molecular weight of 481.64 g/mol. Its IUPAC name is 5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzoyl]benzenesulfinate.
| Compound Name | 5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzoyl]benzenesulfinate |
|---|---|
| PubChem CID | 123936639 |
| Molecular Formula | C31H29O3S- |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)-2-[4-(2,4,6-trimethylphenyl)benzoyl]benzenesulfinate |
| SMILES | Cc1cc(C)c(-c2ccc(C(=O)c3ccc(-c4c(C)cc(C)cc4C)cc3S(=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C31H30O3S/c1-18-13-20(3)29(21(4)14-18)24-7-9-25(10-8-24)31(32)27-12-11-26(17-28(27)35(33)34)30-22(5)15-19(2)16-23(30)6/h7-17H,1-6H3,(H,33,34)/p-1 |
| InChIKey | HYPPMLNHKYMZPX-UHFFFAOYSA-M |
| XLogP | 7.34 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|