C8H9FO2 — CID 123937767
4-fluoro-3-methoxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 123937767) has the molecular formula C8H9FO2 and a molecular weight of 156.16 g/mol. Its IUPAC name is 4-fluoro-3-methoxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 4-fluoro-3-methoxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 123937767 |
| Molecular Formula | C8H9FO2 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 4-fluoro-3-methoxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | COC1=CC(C=O)CC=C1F |
| InChI | InChI=1S/C8H9FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h3-6H,2H2,1H3 |
| InChIKey | FHEWUALKWMLFEH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|