C10H13FO2 — CID 142220231
5-fluoro-4-propan-2-yloxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 142220231) has the molecular formula C10H13FO2 and a molecular weight of 184.21 g/mol. Its IUPAC name is 5-fluoro-4-propan-2-yloxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 5-fluoro-4-propan-2-yloxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 142220231 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 5-fluoro-4-propan-2-yloxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CC(C)OC1=C(F)CC(C=O)C=C1 |
| InChI | InChI=1S/C10H13FO2/c1-7(2)13-10-4-3-8(6-12)5-9(10)11/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | CQBJMGDVMKZJHW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|