C15H16F2O2 — CID 143713239
2,6-difluoro-4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 143713239) has the molecular formula C15H16F2O2 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2,6-difluoro-4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 2,6-difluoro-4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 143713239 |
| Molecular Formula | C15H16F2O2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2,6-difluoro-4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | C=C/C=C(\C=C/C)COC1=CC(F)C(C=O)C(F)=C1 |
| InChI | InChI=1S/C15H16F2O2/c1-3-5-11(6-4-2)10-19-12-7-14(16)13(9-18)15(17)8-12/h3-9,13-14H,1,10H2,2H3/b6-4-,11-5+ |
| InChIKey | PVENNBXLZHIVRX-NQTKGXIKSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|