C29H35Cl2F4N5O2 — CID 123940270
N-[[2,4-dichloro-3-[[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-(2,2-difluoroethoxy)-1-methylbenzimidazol-2-yl]amino]phenyl]methyl]-2,2-dimethylpropanamide (PubChem CID 123940270) has the molecular formula C29H35Cl2F4N5O2 and a molecular weight of 632.53 g/mol. Its IUPAC name is N-[[2,4-dichloro-3-[[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-(2,2-difluoroethoxy)-1-methylbenzimidazol-2-yl]amino]phenyl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[2,4-dichloro-3-[[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-(2,2-difluoroethoxy)-1-methylbenzimidazol-2-yl]amino]phenyl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123940270 |
| Molecular Formula | C29H35Cl2F4N5O2 |
| Molecular Weight | 632.53 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | N-[[2,4-dichloro-3-[[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-(2,2-difluoroethoxy)-1-methylbenzimidazol-2-yl]amino]phenyl]methyl]-2,2-dimethylpropanamide |
| SMILES | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(C)(C)C)c2Cl)nc2cc(CNC3CCC(F)(F)CC3)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C29H35Cl2F4N5O2/c1-28(2,3)26(41)37-13-16-5-6-19(30)25(24(16)31)39-27-38-20-11-17(14-36-18-7-9-29(34,35)10-8-18)22(42-15-23(32)33)12-21(20)40(27)4/h5-6,11-12,18,23,36H,7-10,13-15H2,1-4H3,(H,37,41)(H,38,39) |
| InChIKey | AKMZLPOXEGPQCC-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.53 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |