C27H25Cl2F8N5O3 — CID 88573420
2-[2,6-dichloro-3-[[[1-(trifluoromethyl)cyclopentanecarbonyl]amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide (PubChem CID 88573420) has the molecular formula C27H25Cl2F8N5O3 and a molecular weight of 690.42 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[[[1-(trifluoromethyl)cyclopentanecarbonyl]amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide.
| Compound Name | 2-[2,6-dichloro-3-[[[1-(trifluoromethyl)cyclopentanecarbonyl]amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 88573420 |
| Molecular Formula | C27H25Cl2F8N5O3 |
| Molecular Weight | 690.42 g/mol |
| Exact Mass | 689.12 |
| IUPAC Name | 2-[2,6-dichloro-3-[[[1-(trifluoromethyl)cyclopentanecarbonyl]amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2c(Cl)ccc(CNC(=O)C3(C(F)(F)F)CCCC3)c2Cl)nc2cc(C(=O)NCC(F)(F)F)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C27H25Cl2F8N5O3/c1-42-17-9-18(45-11-19(30)31)14(22(43)39-12-26(32,33)34)8-16(17)40-24(42)41-21-15(28)5-4-13(20(21)29)10-38-23(44)25(27(35,36)37)6-2-3-7-25/h4-5,8-9,19H,2-3,6-7,10-12H2,1H3,(H,38,44)(H,39,43)(H,40,41) |
| InChIKey | BNZQETHFPNUGLG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.42 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |