C18H25BO2 — CID 123941959
12-(3,4-dimethylphenyl)-11,13-dioxa-12-boradispiro[4.0.46.35]tridecane (PubChem CID 123941959) has the molecular formula C18H25BO2 and a molecular weight of 284.21 g/mol. Its IUPAC name is 12-(3,4-dimethylphenyl)-11,13-dioxa-12-boradispiro[4.0.46.35]tridecane.
| Compound Name | 12-(3,4-dimethylphenyl)-11,13-dioxa-12-boradispiro[4.0.46.35]tridecane |
|---|---|
| PubChem CID | 123941959 |
| Molecular Formula | C18H25BO2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 12-(3,4-dimethylphenyl)-11,13-dioxa-12-boradispiro[4.0.46.35]tridecane |
| SMILES | Cc1ccc(B2OC3(CCCC3)C3(CCCC3)O2)cc1C |
| InChI | InChI=1S/C18H25BO2/c1-14-7-8-16(13-15(14)2)19-20-17(9-3-4-10-17)18(21-19)11-5-6-12-18/h7-8,13H,3-6,9-12H2,1-2H3 |
| InChIKey | JQCBYUBMFJXXIX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|