C22H27N5O3 — CID 123942638
2-[2-[(2-cyclohexa-1,5-dien-1-yl-3-cyclohexa-2,4-dien-1-ylpropanoyl)amino]ethylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 123942638) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[2-[(2-cyclohexa-1,5-dien-1-yl-3-cyclohexa-2,4-dien-1-ylpropanoyl)amino]ethylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[2-[(2-cyclohexa-1,5-dien-1-yl-3-cyclohexa-2,4-dien-1-ylpropanoyl)amino]ethylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123942638 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-[2-[(2-cyclohexa-1,5-dien-1-yl-3-cyclohexa-2,4-dien-1-ylpropanoyl)amino]ethylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(NCCNC(=O)C(CC2C=CC=CC2)C2=CCCC=C2)nc1 |
| InChI | InChI=1S/C22H27N5O3/c28-20(27-30)18-14-25-22(26-15-18)24-12-11-23-21(29)19(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1,3-5,7,9-10,14-16,19,30H,2,6,8,11-13H2,(H,23,29)(H,27,28)(H,24,25,26) |
| InChIKey | MMYUQXOUVDGUJI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|