C36H53N3O3 — CID 123943763
tert-butyl 2-[2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]oxolan-3-yl]acetate (PubChem CID 123943763) has the molecular formula C36H53N3O3 and a molecular weight of 575.84 g/mol. Its IUPAC name is tert-butyl 2-[2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]oxolan-3-yl]acetate.
| Compound Name | tert-butyl 2-[2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 123943763 |
| Molecular Formula | C36H53N3O3 |
| Molecular Weight | 575.84 g/mol |
| Exact Mass | 575.41 |
| IUPAC Name | tert-butyl 2-[2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]oxolan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1C(CN2CCN(c3cccc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)n3)CC2)COC1(C)C |
| InChI | InChI=1S/C36H53N3O3/c1-33(2,3)42-32(40)22-28-26(24-41-36(28,8)9)23-38-17-19-39(20-18-38)31-12-10-11-30(37-31)25-13-14-27-29(21-25)35(6,7)16-15-34(27,4)5/h10-14,21,26,28H,15-20,22-24H2,1-9H3 |
| InChIKey | FJUVWLZZKUYMHE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |