C10H13Cl — CID 123945513
5-chloro-6-cyclopropyl-2-methylcyclohexa-1,3-diene (PubChem CID 123945513) has the molecular formula C10H13Cl and a molecular weight of 168.67 g/mol. Its IUPAC name is 5-chloro-6-cyclopropyl-2-methylcyclohexa-1,3-diene.
| Compound Name | 5-chloro-6-cyclopropyl-2-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123945513 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 5-chloro-6-cyclopropyl-2-methylcyclohexa-1,3-diene |
| SMILES | CC1=CC(C2CC2)C(Cl)C=C1 |
| InChI | InChI=1S/C10H13Cl/c1-7-2-5-10(11)9(6-7)8-3-4-8/h2,5-6,8-10H,3-4H2,1H3 |
| InChIKey | FXRHNWILQWUBND-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|