C27H39ClN4O3 — CID 123945610
N-[5-chloro-6-[5-[(2,2-dimethyloxan-4-yl)methylamino]-1-(methylideneamino)penta-1,3-dienyl]-2-methylcyclohepta-1,4,6-trien-1-yl]morpholine-2-carboxamide (PubChem CID 123945610) has the molecular formula C27H39ClN4O3 and a molecular weight of 503.09 g/mol. Its IUPAC name is N-[5-chloro-6-[5-[(2,2-dimethyloxan-4-yl)methylamino]-1-(methylideneamino)penta-1,3-dienyl]-2-methylcyclohepta-1,4,6-trien-1-yl]morpholine-2-carboxamide.
| Compound Name | N-[5-chloro-6-[5-[(2,2-dimethyloxan-4-yl)methylamino]-1-(methylideneamino)penta-1,3-dienyl]-2-methylcyclohepta-1,4,6-trien-1-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 123945610 |
| Molecular Formula | C27H39ClN4O3 |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-[5-chloro-6-[5-[(2,2-dimethyloxan-4-yl)methylamino]-1-(methylideneamino)penta-1,3-dienyl]-2-methylcyclohepta-1,4,6-trien-1-yl]morpholine-2-carboxamide |
| SMILES | C=NC(=CC=CCNCC1CCOC(C)(C)C1)C1=CC(NC(=O)C2CNCCO2)=C(C)CC=C1Cl |
| InChI | InChI=1S/C27H39ClN4O3/c1-19-8-9-22(28)21(15-24(19)32-26(33)25-18-31-12-14-34-25)23(29-4)7-5-6-11-30-17-20-10-13-35-27(2,3)16-20/h5-7,9,15,20,25,30-31H,4,8,10-14,16-18H2,1-3H3,(H,32,33) |
| InChIKey | GOXLOEJIVTXQRO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|