C32H41N5O7 — CID 123946320
4-[[[[(2S)-1-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutylidene]amino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 123946320) has the molecular formula C32H41N5O7 and a molecular weight of 607.71 g/mol. Its IUPAC name is 4-[[[[(2S)-1-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutylidene]amino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[[(2S)-1-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutylidene]amino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123946320 |
| Molecular Formula | C32H41N5O7 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 4-[[[[(2S)-1-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutylidene]amino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(N)=NNC(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C32H41N5O7/c1-32(2,3)44-27(38)16-26(28(33)36-37-30(41)34-17-19-12-14-20(15-13-19)29(39)40)35-31(42)43-18-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h4-11,19-20,25-26H,12-18H2,1-3H3,(H2,33,36)(H,35,42)(H,39,40)(H2,34,37,41)/t19?,20?,26-/m0/s1 |
| InChIKey | XEFBWKGWNJKDMF-SALGDXJJSA-N |
| XLogP | 4.09 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|