C28H34N4O5 — CID 22955030
4-[[[(E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butylideneamino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 22955030) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-[[[(E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butylideneamino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[(E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butylideneamino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 22955030 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 4-[[[(E)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butylideneamino]carbamoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCC(/C=N/NC(=O)NCC1CCC(C(=O)O)CC1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H34N4O5/c1-2-20(16-30-32-27(35)29-15-18-11-13-19(14-12-18)26(33)34)31-28(36)37-17-25-23-9-5-3-7-21(23)22-8-4-6-10-24(22)25/h3-10,16,18-20,25H,2,11-15,17H2,1H3,(H,31,36)(H,33,34)(H2,29,32,35)/b30-16+ |
| InChIKey | AHDGPOTZHYMBPK-OKCVXOCRSA-N |
| XLogP | 4.48 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|