C28H31N4O7- — CID 59947471
(3S,4E)-4-[(4-carboxycyclohexyl)methylcarbamoylhydrazinylidene]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 59947471) has the molecular formula C28H31N4O7- and a molecular weight of 535.58 g/mol. Its IUPAC name is (3S,4E)-4-[(4-carboxycyclohexyl)methylcarbamoylhydrazinylidene]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | (3S,4E)-4-[(4-carboxycyclohexyl)methylcarbamoylhydrazinylidene]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 59947471 |
| Molecular Formula | C28H31N4O7- |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (3S,4E)-4-[(4-carboxycyclohexyl)methylcarbamoylhydrazinylidene]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | O=C([O-])C[C@@H](/C=N/NC(=O)NCC1CCC(C(=O)O)CC1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H32N4O7/c33-25(34)13-19(15-30-32-27(37)29-14-17-9-11-18(12-10-17)26(35)36)31-28(38)39-16-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-8,15,17-19,24H,9-14,16H2,(H,31,38)(H,33,34)(H,35,36)(H2,29,32,37)/p-1/b30-15+/t17?,18?,19-/m0/s1 |
| InChIKey | PRVQZMNYOLLJSH-UHFUIABVSA-M |
| XLogP | 2.21 |
| TPSA | 169.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|