C18H32N2 — CID 123947044
N-[1-(2,2-dimethylbut-3-enylideneamino)-2-methylbuta-1,3-dienyl]-N-methylhexan-1-amine (PubChem CID 123947044) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N-[1-(2,2-dimethylbut-3-enylideneamino)-2-methylbuta-1,3-dienyl]-N-methylhexan-1-amine.
| Compound Name | N-[1-(2,2-dimethylbut-3-enylideneamino)-2-methylbuta-1,3-dienyl]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 123947044 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N-[1-(2,2-dimethylbut-3-enylideneamino)-2-methylbuta-1,3-dienyl]-N-methylhexan-1-amine |
| SMILES | C=CC(C)=C(N=CC(C)(C)C=C)N(C)CCCCCC |
| InChI | InChI=1S/C18H32N2/c1-8-11-12-13-14-20(7)17(16(4)9-2)19-15-18(5,6)10-3/h9-10,15H,2-3,8,11-14H2,1,4-7H3 |
| InChIKey | IDGPAJMOYCTWGI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|