About N-ethenyl-N-heptyl-N'-methylmethanimidamide
N-ethenyl-N-heptyl-N'-methylmethanimidamide (PubChem CID 144548032) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N-ethenyl-N-heptyl-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N-heptyl-N'-methylmethanimidamide |
| PubChem CID | 144548032 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-ethenyl-N-heptyl-N'-methylmethanimidamide |
| SMILES | C=CN(/C=N/C)CCCCCCC |
| InChI | InChI=1S/C11H22N2/c1-4-6-7-8-9-10-13(5-2)11-12-3/h5,11H,2,4,6-10H2,1,3H3/b12-11+ |
| InChIKey | KXICSAYXKCVFBR-VAWYXSNFSA-N |
| XLogP | 3.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-heptyl-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-heptyl-N'-methylmethanimidamide?
The IUPAC name of N-ethenyl-N-heptyl-N'-methylmethanimidamide (CID 144548032) is N-ethenyl-N-heptyl-N'-methylmethanimidamide.
What is the SMILES notation for N-ethenyl-N-heptyl-N'-methylmethanimidamide?
The canonical SMILES for N-ethenyl-N-heptyl-N'-methylmethanimidamide is C=CN(/C=N/C)CCCCCCC.
What is the InChIKey of N-ethenyl-N-heptyl-N'-methylmethanimidamide?
The InChIKey is KXICSAYXKCVFBR-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-6-7-8-9-10-13(5-2)11-12-3/h5,11H,2,4,6-10H2,1,3H3/b12-11+.
What are the key properties of N-ethenyl-N-heptyl-N'-methylmethanimidamide?
N-ethenyl-N-heptyl-N'-methylmethanimidamide has a molecular weight of 182.31 g/mol, XLogP of 3.06, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-heptyl-N'-methylmethanimidamide is sourced from PubChem (CID 144548032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).