C22H13Cl3FNO2S — CID 123949264
1-(3-chloro-2-fluorophenyl)-5-(4-chlorophenyl)-4-(4-chlorophenyl)sulfanylpyrrolidine-2,3-dione (PubChem CID 123949264) has the molecular formula C22H13Cl3FNO2S and a molecular weight of 480.78 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-5-(4-chlorophenyl)-4-(4-chlorophenyl)sulfanylpyrrolidine-2,3-dione.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-5-(4-chlorophenyl)-4-(4-chlorophenyl)sulfanylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123949264 |
| Molecular Formula | C22H13Cl3FNO2S |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-5-(4-chlorophenyl)-4-(4-chlorophenyl)sulfanylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(Cl)c2F)C(c2ccc(Cl)cc2)C1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H13Cl3FNO2S/c23-13-6-4-12(5-7-13)19-21(30-15-10-8-14(24)9-11-15)20(28)22(29)27(19)17-3-1-2-16(25)18(17)26/h1-11,19,21H |
| InChIKey | UNWFNHULPJMOSK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|