C14H29NO2 — CID 123950745
(2-ethyl-2,4,4-trimethylpentyl) 2-(methylamino)propanoate (PubChem CID 123950745) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is (2-ethyl-2,4,4-trimethylpentyl) 2-(methylamino)propanoate.
| Compound Name | (2-ethyl-2,4,4-trimethylpentyl) 2-(methylamino)propanoate |
|---|---|
| PubChem CID | 123950745 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (2-ethyl-2,4,4-trimethylpentyl) 2-(methylamino)propanoate |
| SMILES | CCC(C)(COC(=O)C(C)NC)CC(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-8-14(6,9-13(3,4)5)10-17-12(16)11(2)15-7/h11,15H,8-10H2,1-7H3 |
| InChIKey | QKECMCUFQQABGR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |