C24H48N2O4 — CID 91191101
2,2-dimethylpropyl 3-[3-[[3-(2-ethyl-2,4,4-trimethylpentoxy)-3-oxopropyl]amino]propylamino]propanoate (PubChem CID 91191101) has the molecular formula C24H48N2O4 and a molecular weight of 428.66 g/mol. Its IUPAC name is 2,2-dimethylpropyl 3-[3-[[3-(2-ethyl-2,4,4-trimethylpentoxy)-3-oxopropyl]amino]propylamino]propanoate.
| Compound Name | 2,2-dimethylpropyl 3-[3-[[3-(2-ethyl-2,4,4-trimethylpentoxy)-3-oxopropyl]amino]propylamino]propanoate |
|---|---|
| PubChem CID | 91191101 |
| Molecular Formula | C24H48N2O4 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.36 |
| IUPAC Name | 2,2-dimethylpropyl 3-[3-[[3-(2-ethyl-2,4,4-trimethylpentoxy)-3-oxopropyl]amino]propylamino]propanoate |
| SMILES | CCC(C)(COC(=O)CCNCCCNCCC(=O)OCC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C24H48N2O4/c1-9-24(8,17-22(2,3)4)19-30-21(28)12-16-26-14-10-13-25-15-11-20(27)29-18-23(5,6)7/h25-26H,9-19H2,1-8H3 |
| InChIKey | ZXIYYLGVMBGWLQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|