C28H56N2O5 — CID 135293021
2,2,4,4-tetramethylpentyl N-[3-[(2-ethyl-2,4,4-trimethylpentoxy)carbonylamino]-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate (PubChem CID 135293021) has the molecular formula C28H56N2O5 and a molecular weight of 500.77 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentyl N-[3-[(2-ethyl-2,4,4-trimethylpentoxy)carbonylamino]-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate.
| Compound Name | 2,2,4,4-tetramethylpentyl N-[3-[(2-ethyl-2,4,4-trimethylpentoxy)carbonylamino]-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
|---|---|
| PubChem CID | 135293021 |
| Molecular Formula | C28H56N2O5 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | 2,2,4,4-tetramethylpentyl N-[3-[(2-ethyl-2,4,4-trimethylpentoxy)carbonylamino]-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
| SMILES | CCC(C)(COC(=O)NCC(CNC(=O)OCC(C)(C)CC(C)(C)C)OC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C28H56N2O5/c1-14-28(13,18-25(5,6)7)20-34-23(32)30-16-21(35-26(8,9)10)15-29-22(31)33-19-27(11,12)17-24(2,3)4/h21H,14-20H2,1-13H3,(H,29,31)(H,30,32) |
| InChIKey | OFLXTFLOIPTWBR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |