C18H26O3 — CID 123822881
2,2,4,4-tetramethylpentyl 3-oxo-3-phenylpropanoate (PubChem CID 123822881) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentyl 3-oxo-3-phenylpropanoate.
| Compound Name | 2,2,4,4-tetramethylpentyl 3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 123822881 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2,2,4,4-tetramethylpentyl 3-oxo-3-phenylpropanoate |
| SMILES | CC(C)(C)CC(C)(C)COC(=O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O3/c1-17(2,3)12-18(4,5)13-21-16(20)11-15(19)14-9-7-6-8-10-14/h6-10H,11-13H2,1-5H3 |
| InChIKey | VIDVBPCIZNIALN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|