C18H19ClO3 — CID 123951615
2-[5-chloro-2-[(2,5-dimethylphenoxy)methyl]phenyl]-1,3-dioxolane (PubChem CID 123951615) has the molecular formula C18H19ClO3 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-[5-chloro-2-[(2,5-dimethylphenoxy)methyl]phenyl]-1,3-dioxolane.
| Compound Name | 2-[5-chloro-2-[(2,5-dimethylphenoxy)methyl]phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 123951615 |
| Molecular Formula | C18H19ClO3 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[5-chloro-2-[(2,5-dimethylphenoxy)methyl]phenyl]-1,3-dioxolane |
| SMILES | Cc1ccc(C)c(OCc2ccc(Cl)cc2C2OCCO2)c1 |
| InChI | InChI=1S/C18H19ClO3/c1-12-3-4-13(2)17(9-12)22-11-14-5-6-15(19)10-16(14)18-20-7-8-21-18/h3-6,9-10,18H,7-8,11H2,1-2H3 |
| InChIKey | DNXYMKANDBYXSG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |