C21H20N2O — CID 123952380
3-benzhydrylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate (PubChem CID 123952380) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-benzhydrylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate.
| Compound Name | 3-benzhydrylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate |
|---|---|
| PubChem CID | 123952380 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-benzhydrylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate |
| SMILES | [O-]C1=N[N+](=C(c2ccccc2)c2ccccc2)C2C3CCC(C3)C12 |
| InChI | InChI=1S/C21H20N2O/c24-21-18-16-11-12-17(13-16)20(18)23(22-21)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-18,20H,11-13H2 |
| InChIKey | FNXCEDUFWLBYEB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|