C24H18N2O — CID 123986522
3-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[e]indazol-3-ium-1-olate (PubChem CID 123986522) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[e]indazol-3-ium-1-olate.
| Compound Name | 3-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[e]indazol-3-ium-1-olate |
|---|---|
| PubChem CID | 123986522 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-fluoren-9-ylidene-3a,4,5,9b-tetrahydrobenzo[e]indazol-3-ium-1-olate |
| SMILES | [O-]C1=N[N+](=C2c3ccccc3-c3ccccc32)C2CCc3ccccc3C12 |
| InChI | InChI=1S/C24H18N2O/c27-24-22-16-8-2-1-7-15(16)13-14-21(22)26(25-24)23-19-11-5-3-9-17(19)18-10-4-6-12-20(18)23/h1-12,21-22H,13-14H2 |
| InChIKey | AZIFAPYOEATUCI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|