C20H18N2O — CID 154464351
(3aR,7aS)-1-fluoren-9-ylidene-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-olate (PubChem CID 154464351) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is (3aR,7aS)-1-fluoren-9-ylidene-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-olate.
| Compound Name | (3aR,7aS)-1-fluoren-9-ylidene-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-olate |
|---|---|
| PubChem CID | 154464351 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (3aR,7aS)-1-fluoren-9-ylidene-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-olate |
| SMILES | [O-]C1=N[N+](=C2c3ccccc3-c3ccccc32)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C20H18N2O/c23-20-17-11-5-6-12-18(17)22(21-20)19-15-9-3-1-7-13(15)14-8-2-4-10-16(14)19/h1-4,7-10,17-18H,5-6,11-12H2/t17-,18+/m1/s1 |
| InChIKey | PBDPFVXPPSVMLA-MSOLQXFVSA-N |
| XLogP | 2.76 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|