C22H15FN2O — CID 135062015
2-fluoren-9-ylidene-4-(4-fluorophenyl)-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 135062015) has the molecular formula C22H15FN2O and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-fluoren-9-ylidene-4-(4-fluorophenyl)-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | 2-fluoren-9-ylidene-4-(4-fluorophenyl)-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 135062015 |
| Molecular Formula | C22H15FN2O |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-fluoren-9-ylidene-4-(4-fluorophenyl)-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N[N+](=C2c3ccccc3-c3ccccc32)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15FN2O/c23-15-11-9-14(10-12-15)20-13-25(24-22(20)26)21-18-7-3-1-5-16(18)17-6-2-4-8-19(17)21/h1-12,20H,13H2 |
| InChIKey | VAGLLOCEVMWKIC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|