C22H16N2O — CID 135061544
2-fluoren-9-ylidene-4-phenyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 135061544) has the molecular formula C22H16N2O and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-fluoren-9-ylidene-4-phenyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | 2-fluoren-9-ylidene-4-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 135061544 |
| Molecular Formula | C22H16N2O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-fluoren-9-ylidene-4-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N[N+](=C2c3ccccc3-c3ccccc32)CC1c1ccccc1 |
| InChI | InChI=1S/C22H16N2O/c25-22-20(15-8-2-1-3-9-15)14-24(23-22)21-18-12-6-4-10-16(18)17-11-5-7-13-19(17)21/h1-13,20H,14H2 |
| InChIKey | KKQJXNARNPYPPK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|