C21H18N2O — CID 71656609
(1S,2R,6S,7R)-3-fluoren-9-ylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate (PubChem CID 71656609) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is (1S,2R,6S,7R)-3-fluoren-9-ylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate.
| Compound Name | (1S,2R,6S,7R)-3-fluoren-9-ylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate |
|---|---|
| PubChem CID | 71656609 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (1S,2R,6S,7R)-3-fluoren-9-ylidene-4-aza-3-azoniatricyclo[5.2.1.02,6]dec-4-en-5-olate |
| SMILES | [O-]C1=N[N+](=C2c3ccccc3-c3ccccc32)[C@@H]2[C@H]3CC[C@H](C3)[C@H]12 |
| InChI | InChI=1S/C21H18N2O/c24-21-18-12-9-10-13(11-12)19(18)23(22-21)20-16-7-3-1-5-14(16)15-6-2-4-8-17(15)20/h1-8,12-13,18-19H,9-11H2/t12-,13+,18+,19-/m1/s1 |
| InChIKey | DFQGFFDAECMZAO-MTZMYHNQSA-N |
| XLogP | 2.62 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|